For research use only. Not for therapeutic Use.
4-[4-(2-Propyn-1-yloxy)benzoyl]benzoic Acid is a benzoyl derivative notable for its unique structure, featuring both a propynyl ether and a carboxylic acid functional group. This compound is of interest in organic synthesis and materials science due to its potential applications in drug development and as an intermediate in the production of advanced polymers. Its distinctive properties may enhance reactivity and binding affinity in biological systems, making it a valuable candidate for further research in medicinal chemistry and material applications.
CAS Number | 1236196-77-2 |
Molecular Formula | C17H12O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-(4-prop-2-ynoxybenzoyl)benzoic acid |
InChI | InChI=1S/C17H12O4/c1-2-11-21-15-9-7-13(8-10-15)16(18)12-3-5-14(6-4-12)17(19)20/h1,3-10H,11H2,(H,19,20) |
InChIKey | URDMKFAPEKSQDV-UHFFFAOYSA-N |
SMILES | C#CCOC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |