Home
>
Chemical Reagents>Organic Building Blocks> 4-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenylethynyl]benzoic acid methyl ester
For research use only. Not for therapeutic Use.
4-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenylethynyl]benzoic acid methyl ester is a boronic ester derivative widely used in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions. Its unique structure, combining a boronate group and an ethynyl linkage, enables precise functionalization and facilitates complex molecule assembly. This compound is valuable in pharmaceutical and materials science research, providing high stability and reactivity, which enhance synthesis efficiency in the development of advanced organic compounds and molecular architectures.
CAS Number | 1448637-05-5 |
Molecular Formula | C22H23BO4 |
Purity | ≥95% |
IUPAC Name | methyl 4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl]benzoate |
InChI | InChI=1S/C22H23BO4/c1-21(2)22(3,4)27-23(26-21)19-14-10-17(11-15-19)7-6-16-8-12-18(13-9-16)20(24)25-5/h8-15H,1-5H3 |
InChIKey | SGGJQXOMPWFXNR-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C#CC3=CC=C(C=C3)C(=O)OC |