For research use only. Not for therapeutic Use.
4-(4-Aminophenyl)butyric acid (Cat No.:M060034) is a chemical compound. It features a butyric acid chain substituted with a 4-aminophenyl group. This compound is significant in organic synthesis and chemical research due to its potential applications in various reactions. Aminophenyl-substituted compounds like this are important intermediates for creating diverse molecules, including pharmaceuticals and agrochemicals. The presence of an aminophenyl group adds specific reactivity and functional diversity to the compound. 4-(4-Aminophenyl)butyric acid’s role as a synthetic intermediate contributes to the construction of complex structures for various applications, supporting scientific exploration and innovation.
CAS Number | 15118-60-2 |
Molecular Formula | C10H13NO2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 4-(4-aminophenyl)butanoic acid |
InChI | InChI=1S/C10H13NO2/c11-9-6-4-8(5-7-9)2-1-3-10(12)13/h4-7H,1-3,11H2,(H,12,13) |
InChIKey | RBHLFWNKEWLHBP-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CCCC(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |