For research use only. Not for therapeutic Use.
4-(4-Bromobenzoyl)phenyl acetate is an organic compound featuring a phenyl acetate group linked to a 4-bromobenzoyl moiety. Its chemical formula is C₁₄H₁₃BrO₃. This compound is significant in organic synthesis and medicinal chemistry due to its potential applications in the development of pharmaceuticals and agrochemicals. The presence of the bromine substituent enhances its reactivity, making it a valuable intermediate for various chemical transformations. Its structural features allow for further functionalization, facilitating the design of novel bioactive compounds.
CAS Number | 4306-46-1 |
Synonyms | 4-ACETOXY-4/’-BROMOBENZOPHENONE |
Molecular Formula | C15H11BrO3 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | [4-(4-bromobenzoyl)phenyl] acetate |
InChI | InChI=1S/C15H11BrO3/c1-10(17)19-14-8-4-12(5-9-14)15(18)11-2-6-13(16)7-3-11/h2-9H,1H3 |
InChIKey | IFRAFNJMZOSYKW-UHFFFAOYSA-N |
SMILES | CC(=O)OC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Br |