For research use only. Not for therapeutic Use.
4-(4-Bromophenoxy)benzenesulfonamide is an organic compound featuring a sulfonamide group attached to a phenyl ring, which is further substituted with a bromophenoxy group. This unique structure enhances its chemical reactivity and potential biological activity, making it valuable in medicinal chemistry. The bromine substituent can facilitate electrophilic reactions, while the sulfonamide moiety is known for its pharmacological properties. This compound may serve as an important scaffold in drug discovery, particularly in the development of antimicrobial or anti-inflammatory agents.
CAS Number | 860515-97-5 |
Molecular Formula | C12H10BrNO3S |
Purity | ≥95% |
IUPAC Name | 4-(4-bromophenoxy)benzenesulfonamide |
InChI | InChI=1S/C12H10BrNO3S/c13-9-1-3-10(4-2-9)17-11-5-7-12(8-6-11)18(14,15)16/h1-8H,(H2,14,15,16) |
InChIKey | HJMZIVOZXGSMNO-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1OC2=CC=C(C=C2)Br)S(=O)(=O)N |