For research use only. Not for therapeutic Use.
4-(4-Bromophenyl)-1-methyl-1H-pyrazole(Cat No.:L019181)is a heterocyclic compound featuring a brominated phenyl group attached to a methyl-substituted pyrazole ring. This compound is widely used in pharmaceutical research and organic synthesis as a key intermediate in the development of biologically active molecules, including potential drug candidates. Its structure offers unique reactivity, making it suitable for various chemical transformations, such as cross-coupling reactions. Researchers in medicinal chemistry value this compound for its role in creating novel therapeutics and exploring new pathways in drug discovery and development.
CAS Number | 1191616-45-1 |
Molecular Formula | C10H9BrN2 |
Purity | ≥95% |
IUPAC Name | 4-(4-bromophenyl)-1-methylpyrazole |
InChI | InChI=1S/C10H9BrN2/c1-13-7-9(6-12-13)8-2-4-10(11)5-3-8/h2-7H,1H3 |
InChIKey | NGFPKROKTIBKMD-UHFFFAOYSA-N |
SMILES | CN1C=C(C=N1)C2=CC=C(C=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |