Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4-[(4-Carboxyphenyl)carbamoylamino]benzoic acid
For research use only. Not for therapeutic Use.
4-[(4-Carboxyphenyl)carbamoylamino]benzoic acid (Cat.No:L004006) is a vital compound in medicinal chemistry. Its structure, featuring a carboxyphenylcarbamoylamino group, lends itself to diverse reactivity. This compound plays a significant role as a key intermediate in the synthesis of specialized pharmaceutical agents.
Catalog Number | L004006 |
CAS Number | 1234-27-1 |
Molecular Formula | C15H12N2O5 |
Purity | ≥95% |
IUPAC Name | 4-[(4-carboxyphenyl)carbamoylamino]benzoic acid |
InChI | InChI=1S/C15H12N2O5/c18-13(19)9-1-5-11(6-2-9)16-15(22)17-12-7-3-10(4-8-12)14(20)21/h1-8H,(H,18,19)(H,20,21)(H2,16,17,22) |
InChIKey | CPBPNIAQWUCTAS-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C(=O)O)NC(=O)NC2=CC=C(C=C2)C(=O)O |