For research use only. Not for therapeutic Use.
4-(4-Chlorophenoxy)benzonitrile(Cat No.:L030493)is an organic compound commonly used in pharmaceutical research and organic synthesis. It consists of a benzonitrile core with a 4-chlorophenoxy group attached at the para position. This structure offers significant reactivity, making it valuable as an intermediate in the synthesis of complex molecules, particularly in the development of pharmaceuticals and agrochemicals. The presence of both the nitrile and chlorophenoxy groups allows for versatile chemical modifications, making this compound essential for researchers focused on creating new therapeutic agents and advanced materials.
CAS Number | 74448-92-3 |
Molecular Formula | C13H8ClNO |
Purity | ≥95% |
IUPAC Name | 4-(4-chlorophenoxy)benzonitrile |
InChI | InChI=1S/C13H8ClNO/c14-11-3-7-13(8-4-11)16-12-5-1-10(9-15)2-6-12/h1-8H |
InChIKey | SOTAPBLDXLHNRZ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C#N)OC2=CC=C(C=C2)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |