For research use only. Not for therapeutic Use.
4-(4-Chlorophenyl)benzoic acid is an organic compound with the molecular formula C₁₃H₉ClO₂. It features a benzoic acid structure substituted with a chlorophenyl group at the 4-position. This compound typically appears as a white to light yellow solid and is significant in organic synthesis and pharmaceutical research. Its unique structure may influence its biological activity, making it a candidate for developing new drugs or agrochemicals. Additionally, it serves as an important intermediate in synthesizing various bioactive compounds.
CAS Number | 5748-41-4 |
Molecular Formula | C13H9ClO2 |
Purity | ≥95% |
IUPAC Name | 4-(4-chlorophenyl)benzoic acid |
InChI | InChI=1S/C13H9ClO2/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(15)16/h1-8H,(H,15,16) |
InChIKey | FIMRRWLTRBEAOM-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Cl)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |