Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4-(4-Chlorothiophen-2-yl)-5-(4-cyclohexylpiperazin-1-yl)thiazol-2-amine
For research use only. Not for therapeutic Use.
4-(4-Chlorothiophen-2-yl)-5-(4-cyclohexylpiperazin-1-yl)thiazol-2-amine(CAT: L000409) is a significant compound with applications primarily in pharmaceutical chemistry. This molecule serves as a key intermediate in the synthesis of pharmaceutical agents. Its structure, incorporating a thiazole and piperazine moiety, is instrumental in modulating various biological targets, making it valuable for drug discovery and development.
CAS Number | 570407-42-0 |
Molecular Formula | C17H23ClN4S2 |
Purity | ≥95% |
IUPAC Name | 4-(4-chlorothiophen-2-yl)-5-(4-cyclohexylpiperazin-1-yl)-1,3-thiazol-2-amine |
InChI | InChI=1S/C17H23ClN4S2/c18-12-10-14(23-11-12)15-16(24-17(19)20-15)22-8-6-21(7-9-22)13-4-2-1-3-5-13/h10-11,13H,1-9H2,(H2,19,20) |
InChIKey | FQQOPZRSAIEOGH-UHFFFAOYSA-N |