For research use only. Not for therapeutic Use.
4-[(4-Fluorobenzyl)oxy]-3-methoxybenzaldehyde(Cat No.:L042707)is a key intermediate in the synthesis of complex organic molecules, particularly in pharmaceutical and medicinal chemistry. This fluorinated benzaldehyde derivative is essential for creating bioactive compounds with potential therapeutic applications, including anti-inflammatory and anticancer agents. Its unique structure, featuring both fluorobenzyl and methoxy groups, allows for versatile chemical modifications, making it a valuable tool in drug discovery and development. Researchers utilize this high-purity compound to explore new synthetic pathways and optimize the biological activity of potential drug candidates.
CAS Number | 321432-05-7 |
Molecular Formula | C15H13FO3 |
Purity | ≥95% |
IUPAC Name | 4-[(4-fluorophenyl)methoxy]-3-methoxybenzaldehyde |
InChI | InChI=1S/C15H13FO3/c1-18-15-8-12(9-17)4-7-14(15)19-10-11-2-5-13(16)6-3-11/h2-9H,10H2,1H3 |
InChIKey | PGCCPVWYLPJNBO-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1)C=O)OCC2=CC=C(C=C2)F |