For research use only. Not for therapeutic Use.
4-(4-Hydroxy-3-methoxyphenyl)-3-buten-2-one (Cat.No:M067579) is a natural compound found in various plant sources. It possesses antioxidant properties and is of interest for its potential health benefits. This compound is studied for its role in traditional medicine and as a building block in organic synthesis for drug development.
CAS Number | 1080-12-2 |
Molecular Formula | C11H12O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (E)-4-(4-hydroxy-3-methoxyphenyl)but-3-en-2-one |
InChI | InChI=1S/C11H12O3/c1-8(12)3-4-9-5-6-10(13)11(7-9)14-2/h3-7,13H,1-2H3/b4-3+ |
InChIKey | AFWKBSMFXWNGRE-ONEGZZNKSA-N |
SMILES | CC(=O)C=CC1=CC(=C(C=C1)O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |