For research use only. Not for therapeutic Use.
4-(4-Hydroxyphenoxy)benzoic acid(CAT: L046763) is a versatile compound primarily used in biochemical and pharmaceutical research. Known for its structure that combines a phenolic hydroxyl group with a benzoic acid moiety, it is ideal for applications involving synthetic chemistry and drug development. This compound serves as an intermediate in various chemical reactions and is often utilized in studying biological pathways due to its stability and specific reactivity. Its hydroxyl and carboxyl groups allow for diverse derivatization, making it valuable in creating novel compounds for biomedical research, including the study of oxidative stress and enzyme inhibition.
CAS Number | 500-76-5 |
Molecular Formula | C13H10O4 |
Purity | ≥95% |
IUPAC Name | 4-(4-hydroxyphenoxy)benzoic acid |
InChI | InChI=1S/C13H10O4/c14-10-3-7-12(8-4-10)17-11-5-1-9(2-6-11)13(15)16/h1-8,14H,(H,15,16) |
InChIKey | KLXPCYHWTLAVLN-UHFFFAOYSA-N |