For research use only. Not for therapeutic Use.
4-(4-Hydroxyphenyl)phenylboronic acid(Cat No.:L028764)is a bifunctional aromatic compound widely used in pharmaceutical research and organic synthesis. Featuring both a boronic acid group and a hydroxyphenyl group, this compound is crucial in Suzuki-Miyaura cross-coupling reactions for the formation of carbon-carbon bonds. It is particularly valuable in the development of bioactive molecules, including drug candidates and advanced materials. The presence of the hydroxy group also allows for further functionalization, making it a versatile intermediate in medicinal chemistry and material science. Its high purity ensures consistent results in advanced research applications.
CAS Number | 477760-86-4 |
Molecular Formula | C12H11BO3 |
Purity | ≥95% |
IUPAC Name | [4-(4-hydroxyphenyl)phenyl]boronic acid |
InChI | InChI=1S/C12H11BO3/c14-12-7-3-10(4-8-12)9-1-5-11(6-2-9)13(15)16/h1-8,14-16H |
InChIKey | DGIKALCQCSMOTG-UHFFFAOYSA-N |
SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)O)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |