For research use only. Not for therapeutic Use.
4-(4-Iodo-1H-pyrazol-1-yl)cyclohexanone(Cat No.:L025759)is a specialized chemical compound used in advanced organic synthesis, particularly within the pharmaceutical and medicinal chemistry fields. This molecule features an iodo-substituted pyrazole ring attached to a cyclohexanone structure, providing unique reactivity that is valuable for constructing complex molecular frameworks. It is often utilized as an intermediate in the synthesis of active pharmaceutical ingredients (APIs) and other bioactive compounds. Its high purity and stability make it a crucial tool for researchers and chemists focused on innovative drug development and chemical synthesis projects.
CAS Number | 1227611-94-0 |
Molecular Formula | C9H11IN2O |
Purity | ≥95% |
IUPAC Name | 4-(4-iodopyrazol-1-yl)cyclohexan-1-one |
InChI | InChI=1S/C9H11IN2O/c10-7-5-11-12(6-7)8-1-3-9(13)4-2-8/h5-6,8H,1-4H2 |
InChIKey | FJDBEHZCSTWVAR-UHFFFAOYSA-N |
SMILES | C1CC(=O)CCC1N2C=C(C=N2)I |