For research use only. Not for therapeutic Use.
4,4′-Methylene-13C-dianiline（Cat No.:M037321） is a high-purity isotopically labeled compound featuring carbon-13 atoms, essential for advanced pharmaceutical and biochemical research. This labeled version of 4,4′-Methylene dianiline is crucial for studying its metabolic pathways, chemical reactions, and potential toxicological effects. Its stable isotope labeling ensures precise and reliable analytical results, making it ideal for applications in NMR spectroscopy, environmental monitoring, and industrial chemical studies. The enhanced stability and consistency of 4,4′-Methylene-13C-dianiline make it suitable for various experimental setups, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | M037321 |
| CAS Number | 190778-00-8 |
| Molecular Formula | C13H14N2 |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | 4-[(4-aminophenyl)(113C)methyl]aniline |
| InChI | InChI=1S/C13H14N2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11/h1-8H,9,14-15H2/i9+1 |
| InChIKey | YBRVSVVVWCFQMG-QBZHADDCSA-N |
| SMILES | C1=CC(=CC=C1[13CH2]C2=CC=C(C=C2)N)N |
