For research use only. Not for therapeutic Use.
4-(4-Methylphenyl)-1,3-thiazole(Cat No.:L020161)is a thiazole derivative characterized by a 4-methylphenyl group attached to the thiazole ring. This structural configuration imparts distinctive electronic and physical properties, making it a crucial intermediate in organic synthesis, particularly in the pharmaceutical and materials science sectors. Its thiazole core is known for its ability to stabilize electron-rich systems, enhancing its utility in creating compounds with potential electronic applications. In medicinal chemistry, it’s used to develop molecules with varied biological activities, including antimicrobial and anti-inflammatory properties, leveraging its robust chemical framework for therapeutic innovations.
CAS Number | 1826-19-3 |
Molecular Formula | C10H9NS |
Purity | ≥95% |
IUPAC Name | 4-(4-methylphenyl)-1,3-thiazole |
InChI | InChI=1S/C10H9NS/c1-8-2-4-9(5-3-8)10-6-12-7-11-10/h2-7H,1H3 |
InChIKey | KHTXVFJHWRJTOR-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)C2=CSC=N2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |