For research use only. Not for therapeutic Use.
4-(4-Methylphenyl)-3-thiosemicarbazide is an organic compound featuring a thiosemicarbazide group attached to a 4-methylphenyl (para-tolyl) ring. The thiosemicarbazide moiety, with both sulfur and nitrogen atoms, contributes significant reactivity, enabling it to act as a nucleophile or ligand in coordination chemistry. This compound is of interest in pharmaceutical research due to its potential biological activity, particularly as an intermediate in synthesizing compounds with antimicrobial, antitumor, or anti-inflammatory properties. Its structure allows for diverse chemical modifications.
Catalog Number | M056236 |
CAS Number | 13278-67-6 |
Molecular Formula | C8H11N3S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-amino-3-(4-methylphenyl)thiourea |
InChI | InChI=1S/C8H11N3S/c1-6-2-4-7(5-3-6)10-8(12)11-9/h2-5H,9H2,1H3,(H2,10,11,12) |
InChIKey | IEAWRKQVDLFINI-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)NC(=S)NN |