For research use only. Not for therapeutic Use.
4-[(4-Morpholinylthio)thioxomethyl]-morpholine (Cat.No:M062462) is a chemical compound with potential applications in organic synthesis and pharmaceutical research. Its unique structure features a morpholine ring and a thioxomethylthio group. This compound may be used as a building block or reagent in the development of various organic molecules for scientific and industrial purposes.
CAS Number | 13752-51-7 |
Molecular Formula | C9H16N2O2S2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | morpholin-4-yl morpholine-4-carbodithioate |
InChI | InChI=1S/C9H16N2O2S2/c14-9(10-1-5-12-6-2-10)15-11-3-7-13-8-4-11/h1-8H2 |
InChIKey | HOEFWOBLOGZQIQ-UHFFFAOYSA-N |
SMILES | C1COCCN1C(=S)SN2CCOCC2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |