For research use only. Not for therapeutic Use.
4-(4-Nitrophenyl)-3-morpholinone (Cat No.:R048960) is a chemical compound. It features a morpholinone ring substituted with a 4-nitrophenyl group. This compound is significant in organic synthesis and chemical research due to its potential applications in various reactions. Nitrophenyl-substituted compounds like this are important intermediates for creating diverse molecules, including pharmaceuticals and agrochemicals. The presence of a nitrophenyl group adds reactivity and functional diversity to the compound. 4-(4-Nitrophenyl)-3-morpholinone’s role as a synthetic intermediate contributes to the construction of complex structures for various applications, supporting scientific exploration and innovation.
CAS Number | 446292-04-2 |
Synonyms | 4-(3-Oxo-4-morpholinyl)nitrobenzene; 4-(4-Nitrophenyl)-3-oxomorpholine; 4-(4-Nitrophenyl)morpholin-3-one; |
Molecular Formula | C10H10N2O4 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 4-(4-nitrophenyl)morpholin-3-one |
InChI | InChI=1S/C10H10N2O4/c13-10-7-16-6-5-11(10)8-1-3-9(4-2-8)12(14)15/h1-4H,5-7H2 |
InChIKey | OWMGEFWSGOTGAU-UHFFFAOYSA-N |
SMILES | C1COCC(=O)N1C2=CC=C(C=C2)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |