For research use only. Not for therapeutic Use.
4-(4-(Trifluoromethyl)phenoxy)benzaldehyde(Cat No.:L023882)is a specialized aromatic compound widely used in pharmaceutical and chemical research. Featuring a trifluoromethyl-substituted phenoxy group attached to a benzaldehyde core, this compound serves as a key intermediate in the synthesis of complex molecules, including potential therapeutic agents and advanced materials. Its unique structure allows for diverse chemical modifications, making it valuable in the development of new drugs and fine chemicals. 4-(4-(Trifluoromethyl)phenoxy)benzaldehyde plays a significant role in high-precision synthesis, supporting innovative research and advancements in medicinal chemistry.
CAS Number | 90035-20-4 |
Molecular Formula | C14H9F3O2 |
Purity | ≥95% |
IUPAC Name | 4-[4-(trifluoromethyl)phenoxy]benzaldehyde |
InChI | InChI=1S/C14H9F3O2/c15-14(16,17)11-3-7-13(8-4-11)19-12-5-1-10(9-18)2-6-12/h1-9H |
InChIKey | RFPORHXEHBGCCJ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C=O)OC2=CC=C(C=C2)C(F)(F)F |