For research use only. Not for therapeutic Use.
4-((4-(Trifluoromethyl)phenyl)amino)benzoic acid is an aromatic compound featuring a benzoic acid core with a trifluoromethyl-substituted phenylamino group, commonly used in pharmaceutical and chemical research. Its structure, combining both trifluoromethyl and carboxylic acid functionalities, enhances its reactivity, making it valuable for synthesizing bioactive molecules, particularly in drug development. This compound is useful in designing enzyme inhibitors and receptor modulators, where its electron-withdrawing groups contribute to metabolic stability and molecular interactions. Its stability and versatility support applications in medicinal chemistry.
CAS Number | 617245-73-5 |
Molecular Formula | C14H10F3NO2 |
Purity | ≥95% |
IUPAC Name | 4-[4-(trifluoromethyl)anilino]benzoic acid |
InChI | InChI=1S/C14H10F3NO2/c15-14(16,17)10-3-7-12(8-4-10)18-11-5-1-9(2-6-11)13(19)20/h1-8,18H,(H,19,20) |
InChIKey | XWOQDRPMULQZIL-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C(=O)O)NC2=CC=C(C=C2)C(F)(F)F |