Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 4-(4,4-Dimethylpiperidin-1-YL)benzoic acid
For research use only. Not for therapeutic Use.
4-(4,4-Dimethylpiperidin-1-yl)benzoic acid(CAT: L044823), a benzoic acid derivative with a 4,4-dimethylpiperidinyl substituent, holds significance in pharmaceutical and organic chemistry. The dimethylpiperidinyl group suggests potential interactions with biological targets, making it relevant for drug development. In pharmaceutical research, it could be explored for its effects on receptors or enzymatic pathways, potentially influencing therapeutic pathways. The benzoic acid moiety offers opportunities for chemical modifications, crucial for fine-tuning properties or creating derivatives.
CAS Number | 406233-26-9 |
Molecular Formula | C14H19NO2 |
Purity | ≥95% |
IUPAC Name | 4-(4,4-dimethylpiperidin-1-yl)benzoic acid |
InChI | InChI=1S/C14H19NO2/c1-14(2)7-9-15(10-8-14)12-5-3-11(4-6-12)13(16)17/h3-6H,7-10H2,1-2H3,(H,16,17) |
InChIKey | MNGVOIOJCKRYCZ-UHFFFAOYSA-N |