For research use only. Not for therapeutic Use.
4-(4,6-Dimethoxy-s-triazin-2-yl)-4-methyl-morpholinium chloride is a reagent commonly used in peptide synthesis as a coupling agent. Its triazine ring reacts with carboxyl groups of amino acids, facilitating peptide bond formation. Additionally, the morpholinium group enhances solubility and stability in aqueous solutions. This compound is vital in solid-phase peptide synthesis, enabling the efficient production of peptides and peptide-based pharmaceuticals.
Catalog Number | R042275 |
CAS Number | 3945-69-5 |
Synonyms | 4-(4,6-Dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholinium Chloride; DMTMM |
Molecular Formula | C10H17ClN4O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium;chloride |
InChI | InChI=1S/C10H17N4O3.ClH/c1-14(4-6-17-7-5-14)8-11-9(15-2)13-10(12-8)16-3;/h4-7H2,1-3H3;1H/q+1;/p-1 |
InChIKey | BMTZEAOGFDXDAD-UHFFFAOYSA-M |
SMILES | C[N+]1(CCOCC1)C2=NC(=NC(=N2)OC)OC.[Cl-] |