Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4-(5-(2,6-Dimethoxyphenyl)-3-(methoxycarbonyl)-1H-pyrazol-1-yl)-3-isopropylbenzoic acid
For research use only. Not for therapeutic Use.
4-(5-(2,6-Dimethoxyphenyl)-3-(methoxycarbonyl)-1H-pyrazol-1-yl)-3-isopropylbenzoic acid(Cat No.:L049101)is a complex aromatic compound featuring a pyrazole ring substituted with a dimethoxyphenyl group, a methoxycarbonyl group, and an isopropyl-substituted benzoic acid moiety. This compound is commonly used as an intermediate in pharmaceutical research and organic synthesis, particularly in the development of bioactive molecules. Its intricate structure allows for targeted chemical modifications, making it valuable in medicinal chemistry for drug discovery. 4-(5-(2,6-Dimethoxyphenyl)-3-(methoxycarbonyl)-1H-pyrazol-1-yl)-3-isopropylbenzoic acid is essential for advancing research in complex molecule synthesis.
CAS Number | 184163-80-2 |
Molecular Formula | C23H24N2O6 |
Purity | ≥95% |
IUPAC Name | 4-[5-(2,6-dimethoxyphenyl)-3-methoxycarbonylpyrazol-1-yl]-3-propan-2-ylbenzoic acid |
InChI | InChI=1S/C23H24N2O6/c1-13(2)15-11-14(22(26)27)9-10-17(15)25-18(12-16(24-25)23(28)31-5)21-19(29-3)7-6-8-20(21)30-4/h6-13H,1-5H3,(H,26,27) |
InChIKey | QUQCKWWVCXYNFS-UHFFFAOYSA-N |
SMILES | CC(C)C1=C(C=CC(=C1)C(=O)O)N2C(=CC(=N2)C(=O)OC)C3=C(C=CC=C3OC)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |