Home
>
Chemical Reagents>Organometallic Reagents> 4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)benzoic acid
For research use only. Not for therapeutic Use.
4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)benzoic acid(CAT: L000145) is a compound of significance in organic chemistry and material science. Its action mechanism involves serving as a key intermediate for the synthesis of various organic compounds. In material chemistry, it plays a pivotal role in the development of specialized materials, particularly in the creation of advanced organic compounds and functional coatings.
CAS Number | 62729-39-9 |
Molecular Formula | C12H15BO4 |
Purity | ≥95% |
IUPAC Name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoic acid |
InChI | InChI=1S/C12H15BO4/c1-12(2)7-16-13(17-8-12)10-5-3-9(4-6-10)11(14)15/h3-6H,7-8H2,1-2H3,(H,14,15) |
InChIKey | IGZPAPRBHZGJHV-UHFFFAOYSA-N |