Home
>
Chemical Reagents>Organometallic Reagents> 4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)chlorobenzene
For research use only. Not for therapeutic Use.
4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)chlorobenzene(CAT: L000451) is a compound of significance in organic chemistry. This compound is valuable as a versatile reagent for Suzuki-Miyaura cross-coupling reactions, enabling the introduction of aryl groups into various organic molecules. Its unique boron-containing structure enhances its utility in various organic synthesis processes, making it a valuable resource for researchers.
Catalog Number | L000451 |
CAS Number | 827605-29-8 |
Molecular Formula | C11H14BClO2 |
Purity | ≥95% |
IUPAC Name | 2-(4-chlorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
InChI | InChI=1S/C11H14BClO2/c1-11(2)7-14-12(15-8-11)9-3-5-10(13)6-4-9/h3-6H,7-8H2,1-2H3 |
InChIKey | OHPJVGZKIQIBRZ-UHFFFAOYSA-N |