For research use only. Not for therapeutic Use.
4-(6-(Methoxycarbonyl)naphthalen-2-yl)benzoic acid (CAT: L000173) is a chemical compound with applications in organic chemistry and potentially in the development of pharmaceuticals. Its action mechanism involves its role as a key intermediate for various chemical reactions. In organic chemistry, this compound serves as a versatile building block for the synthesis of complex molecules, including potential pharmaceutical intermediates. It has the potential to contribute significantly to the pharmaceutical industry by aiding in the creation of novel therapeutic compounds.
CAS Number | 660825-19-4 |
Molecular Formula | C19H14O4 |
Purity | ≥95% |
IUPAC Name | 4-(6-methoxycarbonylnaphthalen-2-yl)benzoic acid |
InChI | InChI=1S/C19H14O4/c1-23-19(22)17-9-8-15-10-14(6-7-16(15)11-17)12-2-4-13(5-3-12)18(20)21/h2-11H,1H3,(H,20,21) |
InChIKey | ROTDONXXFNXVNZ-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |