Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4-(6,7-Dimethoxy-quinolin-4-yloxy)-phenylamine
For research use only. Not for therapeutic Use.
4-(6,7-Dimethoxy-quinolin-4-yloxy)-phenylamine is an organic compound featuring a phenylamine structure linked to a quinoline moiety with methoxy substituents at the 6 and 7 positions. This unique arrangement enhances its chemical reactivity and potential biological activity, making it valuable in medicinal chemistry. The quinoline ring contributes to the compound’s electronic properties, while the phenylamine group allows for further derivatization. This compound may be explored for its applications in drug discovery and development, particularly in targeting specific biological pathways.
CAS Number | 190728-25-7 |
Molecular Formula | C17H16N2O3 |
Purity | ≥95% |
IUPAC Name | 4-(6,7-dimethoxyquinolin-4-yl)oxyaniline |
InChI | InChI=1S/C17H16N2O3/c1-20-16-9-13-14(10-17(16)21-2)19-8-7-15(13)22-12-5-3-11(18)4-6-12/h3-10H,18H2,1-2H3 |
InChIKey | VXEQRXJATQUJSN-UHFFFAOYSA-N |
SMILES | COC1=CC2=C(C=CN=C2C=C1OC)OC3=CC=C(C=C3)N |