For research use only. Not for therapeutic Use.
4-Acetamidobenzenesulfonic acid, also known as p-toluenesulfonamide, is an organic compound with applications in chemical synthesis and pharmaceutical manufacturing. It consists of an acetamide group (-NHCOCH3) attached to a benzene ring with a sulfonic acid (-SO3H) group. This compound serves as a reagent in organic reactions, particularly in the formation of amides and as a sulfonating agent. In pharmaceuticals, it is used as a precursor for the synthesis of various drugs and active pharmaceutical ingredients (APIs).
CAS Number | 121-62-0 |
Synonyms | N-Acetylsulfanilic Acid; Acetanilide-p-sulfonic Acid; 4-(Acetylamino)benzenesulfinic Acid; p-Sulfinoacetanilide; |
Molecular Formula | C8H9NO4S |
Purity | ≥95% |
Storage | -20 ℃ |
IUPAC Name | 4-acetamidobenzenesulfonic acid |
InChI | InChI=1S/C8H9NO4S/c1-6(10)9-7-2-4-8(5-3-7)14(11,12)13/h2-5H,1H3,(H,9,10)(H,11,12,13) |
InChIKey | ZQPVMSLLKQTRMG-UHFFFAOYSA-N |
SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)O |