For research use only. Not for therapeutic Use.
4-Acetamidobutanoic acid (Cat.No: I013712 ), also known as N-Acetylaspartic acid (NAA), is a naturally occurring amino acid derivative that is found mainly in the brain and nervous system. It is a common biomarker for brain disorders and injuries. NAA is involved in the regulation of neurotransmitters, cellular energy metabolism, and lipid metabolism in the brain. NAA levels are often used to diagnose and monitor brain disorders such as multiple sclerosis, brain tumors, and stroke.
Catalog Number | I013712 |
CAS Number | 3025-96-5 |
Molecular Formula | C₆H₁₁NO₃ |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | DMSO: 10 mM |
IUPAC Name | 4-acetamidobutanoic acid |
InChI | InChI=1S/C6H11NO3/c1-5(8)7-4-2-3-6(9)10/h2-4H2,1H3,(H,7,8)(H,9,10) |
InChIKey | UZTFMUBKZQVKLK-UHFFFAOYSA-N |
SMILES | CC(=O)NCCCC(=O)O |