For research use only. Not for therapeutic Use.
4-Acetoxy-N-isopropyl-N-methyltryptamine (4-AcO-MiPT) is a synthetic tryptamine used in neuropharmacological research. Known for its psychedelic properties, it is essential for studying the effects on serotonin receptors, brain function, and potential therapeutic applications. This compound aids in understanding the mechanisms of action of psychoactive substances and developing novel treatments for mental health disorders. Researchers rely on 4-Acetoxy-N-isopropyl-N-methyltryptamine for precise and reliable results in advanced psychopharmacology and neuroscience studies.
Catalog Number | R012873 |
CAS Number | 1024612-25-6 |
Synonyms | 4-Acetate 3-[2-[Methyl(1-methylethyl)amino]ethyl]-1H-indol-4-ol; |
Molecular Formula | C16H22N2O2 |
Purity | ≥95% |
Storage | Desiccate at +4 ℃ |
IUPAC Name | [3-[2-[methyl(propan-2-yl)amino]ethyl]-1H-indol-4-yl] acetate |
InChI | InChI=1S/C16H22N2O2/c1-11(2)18(4)9-8-13-10-17-14-6-5-7-15(16(13)14)20-12(3)19/h5-7,10-11,17H,8-9H2,1-4H3 |
InChIKey | CIDMXLOVFPIHDS-UHFFFAOYSA-N |
SMILES | CC(C)N(C)CCC1=CNC2=C1C(=CC=C2)OC(=O)C |