For research use only. Not for therapeutic Use.
4-Acetyl-1-methylcyclohexene is a cyclic compound characterized by an acetyl group at the 4-position and a methyl group at the 1-position of a cyclohexene ring. This compound is notable for its potential applications in organic synthesis, particularly as a building block in the production of more complex molecules. Its unique structure can facilitate various chemical transformations, making it valuable in the development of pharmaceuticals and agrochemicals. Additionally, it may exhibit interesting biological activities, warranting further investigation in medicinal chemistry.
| Catalog Number | L042401 |
| CAS Number | 6090-09-1 |
| Molecular Formula | C9H14O |
| Purity | ≥95% |
| IUPAC Name | 1-(4-methylcyclohex-3-en-1-yl)ethanone |
| InChI | InChI=1S/C9H14O/c1-7-3-5-9(6-4-7)8(2)10/h3,9H,4-6H2,1-2H3 |
| InChIKey | HOBBEYSRFFJETF-UHFFFAOYSA-N |
| SMILES | CC1=CCC(CC1)C(=O)C |
