For research use only. Not for therapeutic Use.
4-Acetyl-2-methylbenzoic acid (Cat.No:L003435) is a notable chemical compound used in various industrial applications. Its structure combines an acetyl and a methyl group, conferring unique reactivity. This compound serves as a crucial intermediate in the synthesis of pharmaceuticals and specialized materials. Its versatile nature and widespread applications underscore its significance in organic synthesis, making it an important component in the realm of chemical research and development.
CAS Number | 55860-35-0 |
Molecular Formula | C10H10O3 |
Purity | ≥95% |
IUPAC Name | 4-acetyl-2-methylbenzoic acid |
InChI | InChI=1S/C10H10O3/c1-6-5-8(7(2)11)3-4-9(6)10(12)13/h3-5H,1-2H3,(H,12,13) |
InChIKey | QGXDUDDPMXVLOO-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=C1)C(=O)C)C(=O)O |