Home
>
Isotope Labeled Compounds>Isotope Labeled Synthetic Intermediates> 4-(Acetylamino)benzenesulfonyl-d5 Chloride
For research use only. Not for therapeutic Use.
4-(Acetylamino)benzenesulfonyl-d5 chloride is a deuterated form of 4-(acetylamino)benzenesulfonyl chloride, a chemical used as a reagent in organic synthesis, particularly in the formation of sulfonamide compounds. The five deuterium atoms replace hydrogen atoms in the molecule, providing a stable isotopic label that enhances its utility in studying reaction mechanisms and analytical processes. This labeled reagent is valuable for precise tracking in NMR spectroscopy and mass spectrometry, aiding in the investigation of chemical reactions, optimization of synthesis protocols, and understanding the behavior of sulfonamide reagents in various chemical contexts
CAS Number | 1020718-84-6 |
Synonyms | 4-(Acetylamino)benzene-2,3,5,6-d5-sulfonyl Chloride; NSC 127860-d5; ASC-d5; 4-[(Acetylamino)phenyl-d5]sulfonyl Chloride; p-Acetamidophenylsulfonyl-d5 Chloride; N-Acetylsulfanilyl-d5 Chloride; Dagenan-d5 Chloride; N-(4-Chlorosulfonylphenyl)?acetamide- |
Molecular Formula | C8H8ClNO3S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-[acetyl(deuterio)amino]-2,3,5,6-tetradeuteriobenzenesulfonyl chloride |
InChI | InChI=1S/C8H8ClNO3S/c1-6(11)10-7-2-4-8(5-3-7)14(9,12)13/h2-5H,1H3,(H,10,11)/i2D,3D,4D,5D/hD |
InChIKey | GRDXCFKBQWDAJH-MDXQMYCFSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1N([2H])C(=O)C)[2H])[2H])S(=O)(=O)Cl)[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |