For research use only. Not for therapeutic Use.
4-Acetylbutyric acid（Cat No.:R019860）is a versatile organic compound commonly used in chemical synthesis and pharmaceutical research. Featuring both a ketone (acetyl) and a carboxylic acid group on a butyric acid chain, it provides dual reactivity, making it valuable for the synthesis of complex molecules. This compound serves as an important intermediate in the development of bioactive substances, including potential drug candidates and fine chemicals. Its structure allows for further modifications, making it useful in medicinal chemistry, agrochemical production, and industrial applications for creating novel materials and therapeutic agents.
| Catalog Number | R019860 |
| CAS Number | 3128-06-1 |
| Synonyms | 4-Acetylbutyric Acid; 5-Ketocaproic Acid; 5-Ketohexanoic Acid; 5-Oxocaproic Acid; 5-Oxohexanoic Acid; NSC 5281; γ-Acetylbutyric Acid; δ-Ketocaproic Acid; δ-Ketohexanoic Acid; δ-Oxocaproic Acid |
| Molecular Formula | C6H10O3 |
| Purity | ≥95% |
| Target | Antibiotic |
| IUPAC Name | 5-oxohexanoic acid |
| InChI | InChI=1S/C6H10O3/c1-5(7)3-2-4-6(8)9/h2-4H2,1H3,(H,8,9) |
| InChIKey | MGTZCLMLSSAXLD-UHFFFAOYSA-N |
| SMILES | CC(=O)CCCC(=O)O |
