For research use only. Not for therapeutic Use.
4-Acetylisoindolin-1-one(CAT: L0406630) is a specialized heterocyclic compound that serves as a valuable intermediate in pharmaceutical and synthetic chemistry. Its structure comprises an isoindolinone core with an acetyl group at the 4-position, offering both stability and functional versatility. This compound is often utilized in the design and synthesis of bioactive molecules, including enzyme inhibitors and receptor modulators. Its unique framework supports diverse chemical transformations, making it a critical building block in medicinal chemistry. Researchers employ 4-Acetylisoindolin-1-one in drug development and structure-activity relationship studies, particularly in fields such as oncology, neuropharmacology, and anti-inflammatory research.
Catalog Number | L040663 |
CAS Number | 1021874-48-5 |
Molecular Formula | C10H9NO2 |
Purity | ≥95% |
IUPAC Name | 4-acetyl-2,3-dihydroisoindol-1-one |
InChI | InChI=1S/C10H9NO2/c1-6(12)7-3-2-4-8-9(7)5-11-10(8)13/h2-4H,5H2,1H3,(H,11,13) |
InChIKey | INJGIFKZMOGGPT-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC=CC2=C1CNC2=O |