For research use only. Not for therapeutic Use.
4-Acetylphenyloxooxazolidinylmethylacetamide(Cat No.:M002760), also known as DuP-721, is a synthetic oxazolidinone antibiotic with broad-spectrum activity against various clinically significant bacteria, including Mycobacterium tuberculosis. It functions by inhibiting bacterial protein synthesis, making it effective against both susceptible and resistant strains. DuP-721 has been studied for its potential in treating tuberculosis and other bacterial infections, particularly those caused by drug-resistant pathogens. Its unique mechanism of action and efficacy highlight its importance in antimicrobial research and the development of new therapeutic agents.
Catalog Number | M002760 |
CAS Number | 104421-21-8 |
Molecular Formula | C12H19N |
Purity | ≥95% |
Storage | Desiccate at -20C |
IUPAC Name | N-[[(5S)-3-(4-acetylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
InChI | InChI=1S/C14H16N2O4/c1-9(17)11-3-5-12(6-4-11)16-8-13(20-14(16)19)7-15-10(2)18/h3-6,13H,7-8H2,1-2H3,(H,15,18)/t13-/m0/s1 |
InChIKey | POXUJOYUVLWPQN-ZDUSSCGKSA-N |
SMILES | CC(=O)C1=CC=C(C=C1)N2C[C@@H](OC2=O)CNC(=O)C |