For research use only. Not for therapeutic Use.
4-Allyl-benzoic acid(Cat No.:M067453) is a chemical compound with the molecular formula C10H10O2. It consists of a benzene ring substituted with a carboxylic acid group (-COOH) at the para position (4th carbon) and an allyl group (-CH2CH=CH2) attached to the benzene ring. This compound is commonly used in organic synthesis as a precursor for the preparation of various allyl-substituted benzene derivatives. Its allyl group allows for further functionalization reactions, making it valuable in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals.
CAS Number | 1076-99-9 |
Synonyms | 4-(2-Propenyl)benzoic acid |
Molecular Formula | C10H10O2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 4-prop-2-enylbenzoic acid |
InChI | InChI=1S/C10H10O2/c1-2-3-8-4-6-9(7-5-8)10(11)12/h2,4-7H,1,3H2,(H,11,12) |
InChIKey | YBCFIVNTXHMQGZ-UHFFFAOYSA-N |
SMILES | C=CCC1=CC=C(C=C1)C(=O)O |
Reference | [1]. Bykov, V.V., Kir'yanov, A.A., Bumagin, N.A. et al.<br /> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |