For research use only. Not for therapeutic Use.
4-(Allyloxy)benzoic acid(CAT: M350977) is an aromatic compound featuring an allyloxy group (-OCH₂CH=CH₂) attached to the 4-position of a benzoic acid ring. This structure is commonly used in organic synthesis and material science due to its combination of a reactive allyl group and a carboxylic acid functionality. The allyl group allows for further modifications through reactions such as polymerization or cross-linking, while the benzoic acid moiety can participate in esterification or amidation reactions. This compound is valuable as a building block in the synthesis of pharmaceuticals, liquid crystals, and functional materials, contributing to applications in drug development and advanced materials engineering.
CAS Number | 27914-60-9 |
Molecular Formula | C10H10O3 |
Purity | ≥95% |
IUPAC Name | 4-prop-2-enoxybenzoic acid |
InChI | InChI=1S/C10H10O3/c1-2-7-13-9-5-3-8(4-6-9)10(11)12/h2-6H,1,7H2,(H,11,12) |
InChIKey | DYDWKSVZHZNBLO-UHFFFAOYSA-N |
SMILES | C=CCOC1=CC=C(C=C1)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |