For research use only. Not for therapeutic Use.
4-(allylseleno)-1-chlorobenzene (Cat. No: M087657) is a benzene ring compound that can be used as a pharmaceutical intermediate in the preparation of chemical raw materials mainly for scientific research.
| Catalog Number | M087657 |
| CAS Number | 17508-29-1 |
| Molecular Formula | C9H9ClSe |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | 1-chloro-4-prop-2-enylselanylbenzene |
| InChI | InChI=1S/C9H9ClSe/c1-2-7-11-9-5-3-8(10)4-6-9/h2-6H,1,7H2 |
| InChIKey | YPYNRHWRFOGAGS-UHFFFAOYSA-N |
| SMILES | C=CC[Se]C1=CC=C(C=C1)Cl |
