For research use only. Not for therapeutic Use.
4-Amino-1-methyl-1H-pyrazole-5-carbonitrile is an organic compound characterized by a pyrazole ring with an amino group (-NH₂) at the fourth position, a methyl group at the first position, and a cyano group (-C≡N) at the fifth position. Its chemical formula is C₅H₆N₄. This compound is of interest in medicinal chemistry due to its potential biological activities, including anti-inflammatory and anticancer properties. The combination of functional groups enhances its reactivity, making it a valuable building block for drug development and synthesis.
CAS Number | 1393101-11-5 |
Molecular Formula | C5H6N4 |
Purity | ≥95% |
IUPAC Name | 4-amino-2-methylpyrazole-3-carbonitrile |
InChI | InChI=1S/C5H6N4/c1-9-5(2-6)4(7)3-8-9/h3H,7H2,1H3 |
InChIKey | DKIXJJWMOCKVJG-UHFFFAOYSA-N |
SMILES | CN1C(=C(C=N1)N)C#N |