Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4-Amino-1-phenyl-1H-pyrazole-3-carboxylic acid
For research use only. Not for therapeutic Use.
4-Amino-1-phenyl-1H-pyrazole-3-carboxylic acid(Cat No.:L038070)is a pyrazole-based compound widely used in pharmaceutical research. Featuring an amino group and a carboxylic acid moiety attached to a phenyl-substituted pyrazole ring, this compound is a valuable intermediate for synthesizing bioactive molecules. It plays a crucial role in the development of potential therapeutic agents, particularly in anti-inflammatory, anticancer, and antimicrobial research. Its unique structure allows for various chemical modifications, making it a versatile tool for medicinal chemists focused on drug discovery and development.
Catalog Number | L038070 |
CAS Number | 64299-26-9 |
Molecular Formula | C10H9N3O2 |
Purity | ≥95% |
IUPAC Name | 4-amino-1-phenylpyrazole-3-carboxylic acid |
InChI | InChI=1S/C10H9N3O2/c11-8-6-13(12-9(8)10(14)15)7-4-2-1-3-5-7/h1-6H,11H2,(H,14,15) |
InChIKey | YAAFWVJWMRAZOW-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)N2C=C(C(=N2)C(=O)O)N |