For research use only. Not for therapeutic Use.
4-Amino-1H-indazol-3-ol(CAT: L016430) is a high-purity heterocyclic compound featuring an indazole core with amino and hydroxyl functional groups. This unique structure makes it a versatile intermediate in pharmaceutical research and organic synthesis, particularly in the development of bioactive molecules, kinase inhibitors, and small-molecule therapeutics. The presence of the amino and hydroxyl groups enables targeted functionalization, facilitating the synthesis of complex derivatives and advanced materials. Known for its reactivity and stability, 4-Amino-1H-indazol-3-ol supports innovative research pathways in medicinal chemistry, providing precision and reliability for both academic and industrial applications.
CAS Number | 89792-08-5 |
Molecular Formula | C7H7N3O |
Purity | ≥95% |
IUPAC Name | 4-amino-1,2-dihydroindazol-3-one |
InChI | InChI=1S/C7H7N3O/c8-4-2-1-3-5-6(4)7(11)10-9-5/h1-3H,8H2,(H2,9,10,11) |
InChIKey | WXOHKLHBFVRPFS-UHFFFAOYSA-N |
SMILES | C1=CC(=C2C(=C1)NNC2=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |