For research use only. Not for therapeutic Use.
4-Amino-2-chlorobenzenesulfonamide(Cat No.:L023073)is an aromatic sulfonamide compound widely used in pharmaceutical research and chemical synthesis. It features an amino group at the 4-position and a chlorine atom at the 2-position on the benzenesulfonamide ring, making it a versatile intermediate in creating various bioactive molecules. This compound is particularly important in developing antibacterial, antifungal, and anti-inflammatory agents. Its unique structure allows for multiple chemical modifications, making 4-Amino-2-chlorobenzenesulfonamide an essential building block for medicinal chemists focused on drug discovery and development.
CAS Number | 1954-94-5 |
Molecular Formula | C6H7ClN2O2S |
Purity | ≥95% |
IUPAC Name | 4-amino-2-chlorobenzenesulfonamide |
InChI | InChI=1S/C6H7ClN2O2S/c7-5-3-4(8)1-2-6(5)12(9,10)11/h1-3H,8H2,(H2,9,10,11) |
InChIKey | NIDOTDANGJJHPU-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1N)Cl)S(=O)(=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |