For research use only. Not for therapeutic Use.
4-Amino-2-methoxy-N-methylbenzamide(Cat No.:L007460), is a significant organic compound with diverse applications. It features an amino group, a methoxy group, and a methylbenzamide structure. This compound has utility in medicinal chemistry and pharmaceutical research, often utilized as a key intermediate in the synthesis of various drugs. Researchers leverage its unique chemical properties for designing and developing novel medications. Additionally, it serves as a valuable building block in organic synthesis, contributing to the creation of complex molecular structures used in pharmaceuticals and other industries.
CAS Number | 75955-35-0 |
Molecular Formula | C9H12N2O2 |
Purity | ≥95% |
IUPAC Name | 4-amino-2-methoxy-N-methylbenzamide |
InChI | InChI=1S/C9H12N2O2/c1-11-9(12)7-4-3-6(10)5-8(7)13-2/h3-5H,10H2,1-2H3,(H,11,12) |
InChIKey | GTYXXHFWHCWIDY-UHFFFAOYSA-N |
SMILES | CNC(=O)C1=C(C=C(C=C1)N)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |