For research use only. Not for therapeutic Use.
4-Amino-2-(methylthio)pyridine(CAT: L031133) is a high-purity heterocyclic compound featuring an amino group at the 4-position and a methylthio group at the 2-position of a pyridine ring. This versatile molecule is widely utilized in pharmaceutical research and organic synthesis, serving as a key intermediate for the development of bioactive compounds, including enzyme inhibitors and therapeutic agents. Its unique structure and reactivity make it suitable for diverse chemical transformations and advanced material development. 4-Amino-2-(methylthio)pyridine is a reliable choice for innovative research in medicinal chemistry, agrochemicals, and fine chemical production.
CAS Number | 59243-39-9 |
Molecular Formula | C6H8N2S |
Purity | ≥95% |
IUPAC Name | 2-methylsulfanylpyridin-4-amine |
InChI | InChI=1S/C6H8N2S/c1-9-6-4-5(7)2-3-8-6/h2-4H,1H3,(H2,7,8) |
InChIKey | MZSQIZRESVBKIM-UHFFFAOYSA-N |
SMILES | CSC1=NC=CC(=C1)N |