For research use only. Not for therapeutic Use.
4-Amino-2,6-difluorobenzaldehyde is an aromatic compound characterized by a benzaldehyde group with an amino substituent at the 4-position and two fluorine atoms at the 2 and 6 positions. This unique arrangement enhances its electronic properties and reactivity, making it useful in organic synthesis and medicinal chemistry. The amino group can facilitate hydrogen bonding and enhance biological activity, while the difluorobenzene moiety may influence pharmacokinetics. This compound may serve as a valuable intermediate in developing pharmaceuticals and agrochemicals.
Catalog Number | L032395 |
CAS Number | 777089-82-4 |
Molecular Formula | C7H5F2NO |
Purity | ≥95% |
IUPAC Name | 4-amino-2,6-difluorobenzaldehyde |
InChI | InChI=1S/C7H5F2NO/c8-6-1-4(10)2-7(9)5(6)3-11/h1-3H,10H2 |
InChIKey | JVVIRMCAOKEHPX-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1F)C=O)F)N |