For research use only. Not for therapeutic Use.
4-Amino-3-(methoxycarbonyl)benzoic acid(Cat No.:L032546)is a multifunctional compound commonly used in organic synthesis and pharmaceutical research. It features both an amino group and a methoxycarbonyl moiety on a benzoic acid core, making it highly reactive and versatile for various chemical reactions. This compound serves as an important intermediate in the synthesis of bioactive molecules, including potential therapeutic agents. Its structure allows for further chemical modifications, facilitating the design of novel compounds in drug discovery, medicinal chemistry, and other fine chemical applications such as agrochemicals and advanced materials.
CAS Number | 41684-07-5 |
Molecular Formula | C9H9NO4 |
Purity | ≥95% |
IUPAC Name | 4-amino-3-methoxycarbonylbenzoic acid |
InChI | InChI=1S/C9H9NO4/c1-14-9(13)6-4-5(8(11)12)2-3-7(6)10/h2-4H,10H2,1H3,(H,11,12) |
InChIKey | XEOVONVMDYDZRL-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C=CC(=C1)C(=O)O)N |