For research use only. Not for therapeutic Use.
4-Amino-3-Methyl-2-(Trifluoromethyl)Benzonitrile(Cat No.:L007077), is a specialized organic compound utilized in pharmaceutical research. It features an aminomethyl group (-NH2) attached to the 4-position, a methyl group (-CH3) at the 3-position, and a trifluoromethyl group (-CF3) at the 2-position of the benzene ring, with a nitrile functional group (-C≡N) on the same ring. This compound’s unique structure lends itself to diverse chemical transformations, making it valuable in the synthesis of complex molecules for drug discovery and development.
CAS Number | 573764-86-0 |
Molecular Formula | C9H7F3N2 |
Purity | ≥95% |
IUPAC Name | 4-amino-3-methyl-2-(trifluoromethyl)benzonitrile |
InChI | InChI=1S/C9H7F3N2/c1-5-7(14)3-2-6(4-13)8(5)9(10,11)12/h2-3H,14H2,1H3 |
InChIKey | FGBKSQXFNVUCEN-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=C1C(F)(F)F)C#N)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |